CAS 90066-13-0
:3-carboxy-4-[6-(diethylamino)-3-(diethyliminio)-3H-xanthen-9-yl]benzoate
Description:
3-Carboxy-4-[6-(diethylamino)-3-(diethyliminio)-3H-xanthen-9-yl]benzoate, with the CAS number 90066-13-0, is a synthetic organic compound that belongs to the class of xanthene dyes. This substance is characterized by its complex structure, which includes a xanthene core substituted with various functional groups, notably a carboxylic acid and a diethylamino group. The presence of the carboxylate moiety enhances its solubility in polar solvents, making it useful in various applications, including as a dye or fluorescent marker. The diethylamino groups contribute to its electronic properties, potentially affecting its absorption and emission characteristics, which are critical for applications in fluorescence microscopy and other imaging techniques. Additionally, the compound may exhibit pH-dependent behavior due to the carboxylic acid group, influencing its ionization state and, consequently, its reactivity and interaction with biological systems. Overall, this compound's unique structural features make it valuable in research and industrial applications, particularly in the fields of biochemistry and materials science.
Formula:C29H30N2O5
InChI:InChI=1/C29H30N2O5/c1-5-30(6-2)19-10-13-22-25(16-19)36-26-17-20(31(7-3)8-4)11-14-23(26)27(22)21-12-9-18(28(32)33)15-24(21)29(34)35/h9-17H,5-8H2,1-4H3,(H-,32,33,34,35)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.