CAS 90071-62-8

tert-butyl D-prolinate

Description:

Tert-butyl D-prolinate, with the CAS number 90071-62-8, is an organic compound that belongs to the class of proline derivatives. It features a tert-butyl group attached to the nitrogen of the proline structure, which is an amino acid. This compound is characterized by its chiral nature, as proline itself is an amino acid with a specific stereochemistry. Tert-butyl D-prolinate is typically a white to off-white solid and is soluble in organic solvents, making it useful in various chemical reactions and synthesis processes. It is often employed in peptide synthesis and as a chiral auxiliary in asymmetric synthesis due to its ability to influence the stereochemical outcome of reactions. The presence of the tert-butyl group enhances its stability and solubility, while the proline moiety contributes to its biological relevance. As with many chemical substances, handling should be done with care, following appropriate safety protocols to mitigate any potential hazards associated with its use.

Formula: C₉H₁₇NO₂

InChI: InChI=1/C9H17NO2/c1-9(2,3)12-8(11)7-5-4-6-10-7/h7,10H,4-6H2,1-3H3/t7-/m1/s1

SMILES: CC(C)(C)OC(=O)[C@H]1CCCN1

Synonyms:

• H-D-Pro-Otbu

D-Proline tert-butyl ester

CAS: 90071-62-8

Formula: C₉H₁₇NO₂

Purity: 97%

Color and Shape: Liquid

Molecular weight: 171.2368

Ref: IN-DA003AAX

D-Proline t-butyl ester

CAS: 90071-62-8

Molecular weight: 171.2

Ref: 7W-GM0817

H-D-Pro-otbu

CAS: 90071-62-8

H-D-Pro-otbu

Purity: 98%

Molecular weight: 171.24g/mol

Ref: 54-OR964379

H-D-Pro-Otbu

CAS: 90071-62-8

Formula: C₉H₁₇NO₂

Purity: 95%

Color and Shape: Liquid, Oil

Molecular weight: 171.24

Ref: 10-F209560