CAS 900711-15-1

N-(3-acetamidophenyl)-3-chloro-propanamide

Description:

N-(3-acetamidophenyl)-3-chloro-propanamide, with the CAS number 900711-15-1, is an organic compound characterized by its amide functional group, which is indicative of its potential as a pharmaceutical or biochemical agent. This compound features a chloro substituent on the propanamide backbone, which may influence its reactivity and biological activity. The presence of the acetamido group attached to a phenyl ring suggests that it may exhibit specific interactions with biological targets, potentially making it useful in medicinal chemistry. The molecular structure implies that it could participate in hydrogen bonding due to the amide and acetamido functionalities, affecting its solubility and stability in various solvents. Additionally, the chlorinated moiety may enhance its lipophilicity, impacting its pharmacokinetic properties. Overall, the characteristics of this compound suggest it may have applications in drug development or as a research chemical, although specific biological activities and safety profiles would require further investigation through empirical studies.

Formula: C₁₁H₁₃ClN₂O₂

InChI: InChI=1/C11H13ClN2O2/c1-8(15)13-9-3-2-4-10(7-9)14-11(16)5-6-12/h2-4,7H,5-6H2,1H3,(H,13,15)(H,14,16)

SMILES: CC(=Nc1cccc(c1)N=C(CCCl)O)O

N-[3-(Acetylamino)phenyl]-3-chloropropanamide

CAS: 900711-15-1

Formula: C₁₁H₁₃ClN₂O₂

Molecular weight: 240.6861

Ref: IN-DA00GVMH