CAS 900796-46-5
:B-(4′-Ethyl-3-fluoro[1,1′-biphenyl]-4-yl)boronic acid
Description:
B-(4′-Ethyl-3-fluoro[1,1′-biphenyl]-4-yl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The compound features a biphenyl structure with an ethyl group and a fluorine atom substituent, contributing to its unique electronic and steric properties. The presence of the boronic acid moiety allows for participation in Suzuki-Miyaura cross-coupling reactions, facilitating the formation of carbon-carbon bonds. This compound may exhibit moderate solubility in organic solvents and can be sensitive to moisture due to the boronic acid group. Its reactivity and functionalization potential make it a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals. Additionally, the specific arrangement of substituents can influence its biological activity and interaction with other molecules, making it a subject of interest in drug discovery and development.
Formula:C14H14BFO2
InChI:InChI=1S/C14H14BFO2/c1-2-10-3-5-11(6-4-10)12-7-8-13(15(17)18)14(16)9-12/h3-9,17-18H,2H2,1H3
InChI key:InChIKey=XNSDNLHVCQYSOC-UHFFFAOYSA-N
SMILES:FC=1C=C(C=CC1B(O)O)C2=CC=C(CC)C=C2
Synonyms:- Boronic acid, B-(4′-ethyl-3-fluoro[1,1′-biphenyl]-4-yl)-
- Boronic acid, (4′-ethyl-3-fluoro[1,1′-biphenyl]-4-yl)-
- [4-(4-Ethylphenyl)-2-fluorophenyl]boronic acid
- B-(4′-Ethyl-3-fluoro[1,1′-biphenyl]-4-yl)boronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
B-(4′-Ethyl-3-fluoro[1,1′-biphenyl]-4-yl)boronic acid
CAS:Formula:C14H14BFO2Molecular weight:244.0692
