CAS 9008-22-4: Laminaran
Description:Laminaran, with the CAS number 9008-22-4, is a polysaccharide primarily derived from brown algae, particularly species of the Laminaria genus. It is a linear β-glucan composed of glucose units linked by β-1,3 and β-1,6 glycosidic bonds. Laminaran is known for its solubility in water, forming viscous solutions, which makes it useful in various applications, including food, pharmaceuticals, and biotechnology. It serves as a source of energy for certain marine organisms and has been studied for its potential health benefits, including immunomodulatory effects and prebiotic properties. Additionally, laminaran can be utilized in the development of biodegradable materials and as a thickening agent in various formulations. Its structural characteristics contribute to its functional properties, making it a subject of interest in both research and industrial applications. Overall, laminaran is valued for its natural origin and versatility in multiple fields.
Formula:Unspecified
InChI:InChI=1/C18H32O16/c19-1-4-7(22)10(25)11(26)17(31-4)34-15-9(24)6(3-21)32-18(13(15)28)33-14-8(23)5(2-20)30-16(29)12(14)27/h4-29H,1-3H2/t4-,5-,6-,7-,8-,9-,10+,11-,12-,13-,14+,15+,16?,17?,18?/m1/s1
- Synonyms:
- Frontiere
- Goemar H 11
- Iodus 40
- Laminarin
- Laminarine
- β-1,3-Glucan
- β-<span class="text-smallcaps">D</span>-Glucan, (1→3)-
- β-D-Glucan, (1→3)-
- D-glucopyranosyl-(1->3)-D-glucopyranosyl-(1->3)-D-glucopyranose
- Laminaran
- See more synonyms
- laminarin from laminaria digitata