
CAS 900816-51-5
:1-[6-(1,1-Dimethylethyl)-2-pyridinyl]ethanone
Description:
1-[6-(1,1-Dimethylethyl)-2-pyridinyl]ethanone, identified by its CAS number 900816-51-5, is an organic compound characterized by its pyridine ring and ketone functional group. This substance features a bulky tert-butyl group attached to the pyridine, which influences its steric and electronic properties. The presence of the ketone group contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic additions. The compound is likely to exhibit moderate polarity due to the electronegative nitrogen in the pyridine ring and the carbonyl group, affecting its solubility in polar and non-polar solvents. Additionally, the structural features suggest potential applications in pharmaceuticals or agrochemicals, where such derivatives can serve as intermediates or active ingredients. Its stability and reactivity can be influenced by environmental factors such as temperature and pH, which are important considerations for handling and storage. Overall, this compound exemplifies the diverse chemistry associated with pyridine derivatives.
Formula:C11H15NO
InChI:InChI=1S/C11H15NO/c1-8(13)9-6-5-7-10(12-9)11(2,3)4/h5-7H,1-4H3
InChI key:InChIKey=ICLZQIRRIOZPKN-UHFFFAOYSA-N
SMILES:C(C)(C)(C)C=1N=C(C(C)=O)C=CC1
Synonyms:- 1-[6-(1,1-Dimethylethyl)-2-pyridinyl]ethanone
- Ethanone, 1-[6-(1,1-dimethylethyl)-2-pyridinyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.