CAS 90084-76-7
:4-bromo-6-oxabicyclo[3.2.1]octan-7-one
Description:
4-Bromo-6-oxabicyclo[3.2.1]octan-7-one is a bicyclic organic compound characterized by its unique structural framework, which includes a bromine atom and an oxabicyclic system. The compound features a bicyclo[3.2.1]octane core, which consists of two fused cyclopropane rings and a ketone functional group at the 7-position. The presence of the bromine substituent at the 4-position contributes to its reactivity and potential applications in organic synthesis. The oxabicyclic structure introduces an oxygen atom into the ring system, which can influence the compound's polarity and solubility in various solvents. This compound may exhibit interesting chemical properties, including potential for nucleophilic substitution reactions due to the electrophilic nature of the carbonyl group. Its unique structure makes it a subject of interest in medicinal chemistry and materials science, where it could serve as a building block for more complex molecules. As with many brominated compounds, it is essential to handle it with care due to potential toxicity and environmental considerations.
Formula:C7H9BrO2
InChI:InChI=1/C7H9BrO2/c8-5-2-1-4-3-6(5)10-7(4)9/h4-6H,1-3H2
SMILES:C1CC(C2CC1C(=O)O2)Br
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.