CAS 90085-12-4

N,N,1-trimethyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine

Description:

N,N,1-trimethyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine is a heterocyclic organic compound characterized by its unique pyrazolo-pyrimidine structure. This compound features a pyrazole ring fused to a pyrimidine ring, which contributes to its potential biological activity. The presence of three methyl groups attached to the nitrogen atoms enhances its lipophilicity, potentially influencing its solubility and permeability in biological systems. It is often studied for its pharmacological properties, particularly in the context of medicinal chemistry, where such compounds may exhibit activity against various biological targets. The compound's molecular structure suggests it may participate in hydrogen bonding and other interactions due to the presence of amine functional groups. As with many heterocycles, its reactivity can be influenced by the electronic properties of the nitrogen atoms and the overall ring system. Safety and handling considerations should be taken into account, as with any chemical substance, particularly in laboratory settings.

Formula: C₈H₁₁N₅

InChI: InChI=1/C8H11N5/c1-12(2)7-6-4-11-13(3)8(6)10-5-9-7/h4-5H,1-3H3

SMILES: CN(C)c1c2cnn(C)c2ncn1

Synonyms:

• 1H-Pyrazolo[3,4-d]pyrimidin-4-amine, N,N,1-trimethyl-
• 1H-Pyrazolo[3,4-d]pyrimidine, 4-(dimethylamino)-1-methyl-