CymitQuimica logo

CAS 90086-90-1

:

5-Amino-2,3-dimethylphenol

Description:
5-Amino-2,3-dimethylphenol is an organic compound characterized by the presence of an amino group and two methyl groups attached to a phenolic ring. Its molecular structure features a phenol backbone, which contributes to its reactivity and potential applications in various chemical processes. The amino group (-NH2) enhances its solubility in water and can participate in various chemical reactions, such as electrophilic substitution and coupling reactions. The methyl groups at the 2 and 3 positions on the aromatic ring influence the compound's electronic properties and steric hindrance, affecting its reactivity and interaction with other molecules. This compound is often used in the synthesis of dyes, pigments, and pharmaceuticals due to its ability to undergo further chemical modifications. Additionally, it may exhibit biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C8H11NO
InChI:InChI=1S/C8H11NO/c1-5-3-7(9)4-8(10)6(5)2/h3-4,10H,9H2,1-2H3
InChI key:InChIKey=DVECBUWKXMPCAA-UHFFFAOYSA-N
SMILES:CC1=C(C)C=C(N)C=C1O
Synonyms:
  • 2,3-Xylenol, 5-amino-
  • 5-Amino-2,3-dimethylphenol
  • Phenol, 5-amino-2,3-dimethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.