CAS 90090-64-5
:2-(thiophen-2-yl)pyrrolidine
Description:
2-(Thiophen-2-yl)pyrrolidine is an organic compound characterized by the presence of a pyrrolidine ring substituted with a thiophene group. The molecular structure features a five-membered nitrogen-containing ring (pyrrolidine) fused with a thiophene, which is a five-membered aromatic ring containing sulfur. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It exhibits properties common to both heterocyclic compounds, such as potential biological activity and the ability to participate in various chemical reactions. The presence of the thiophene moiety can enhance its electronic properties, making it of interest in materials science and medicinal chemistry. Additionally, 2-(thiophen-2-yl)pyrrolidine may exhibit solubility in organic solvents, and its reactivity can be influenced by the functional groups present in its structure. Overall, this compound is significant in research contexts, particularly in the development of pharmaceuticals and agrochemicals.
Formula:C8H12NS
InChI:InChI=1/C8H11NS/c1-3-7(9-5-1)8-4-2-6-10-8/h2,4,6-7,9H,1,3,5H2/p+1/t7-/m0/s1
Synonyms:- 2-Thien-2-Ylpyrrolidine
- 2-(2-Thienyl)Pyrrolidine
- (2R)-2-(thiophen-2-yl)pyrrolidinium
- (2S)-2-(thiophen-2-yl)pyrrolidinium
- 2-(Thien-2-Yl)Pyrrolidine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-(Thien-2-yl)pyrrolidine
CAS:2-(Thien-2-yl)pyrrolidinePurity:95%Color and Shape:LiquidMolecular weight:153.24g/mol2-(2-Thienyl)pyrrolidine
CAS:Controlled ProductApplications 2-(2-Thienyl)pyrrolidine is used in the preparation of imidazopyridine derivatives for treating viral infections.
References Serradeil-Le Gal, C., et al.: J. Pharmacol. Exp. Ther., 300, 1122 (2002), Hodgson, R., et al.: Pharmacol. Biochem. Behav., 3, 431 (2007),Formula:C8H11NSColor and Shape:NeatMolecular weight:153.242-(2-Thienyl)pyrrolidine Hydrochloride
CAS:Controlled ProductApplications 2-(2-Thienyl)pyrrolidine Hydrochloride, is used in the preparation of imidazopyridine derivatives for treating viral infections.
Formula:C8H11NS·HClColor and Shape:NeatMolecular weight:189.706



