CAS 90109-64-1
:3-bromo-4,5-diethoxybenzaldehyde
Description:
3-Bromo-4,5-diethoxybenzaldehyde is an organic compound characterized by its aromatic structure, featuring a bromine atom and two ethoxy groups attached to a benzaldehyde moiety. The presence of the bromine substituent introduces a degree of electrophilicity, which can influence its reactivity in various chemical reactions, such as nucleophilic substitutions or coupling reactions. The ethoxy groups enhance the solubility of the compound in organic solvents and can also affect its electronic properties, making it a potential candidate for applications in organic synthesis and material science. This compound typically appears as a pale yellow to light brown solid or liquid, depending on its purity and specific conditions. Its functional groups allow for various chemical transformations, making it useful in the synthesis of more complex organic molecules. Additionally, the compound's structure suggests potential applications in pharmaceuticals or agrochemicals, where the bromine and ethoxy functionalities can play significant roles in biological activity or interaction with other chemical entities.
Formula:C11H13BrO3
InChI:InChI=1/C11H13BrO3/c1-3-14-10-6-8(7-13)5-9(12)11(10)15-4-2/h5-7H,3-4H2,1-2H3
SMILES:CCOc1cc(cc(c1OCC)Br)C=O
Synonyms:- 3-Bromo-4,5-diethoxy-benzaldehyde
- Benzaldehyde, 3-Bromo-4,5-Diethoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
