CAS 9011-02-3
:Dihydroxydimethyldiphenylmethanedisulphonic acid polymer
Description:
Dihydroxydimethyldiphenylmethanedisulphonic acid polymer, with the CAS number 9011-02-3, is a synthetic polymer characterized by its complex structure, which includes multiple functional groups that contribute to its chemical properties. This polymer is typically used in various applications due to its excellent thermal stability, chemical resistance, and ability to form strong bonds with other materials. It often exhibits high solubility in polar solvents, making it suitable for use in coatings, adhesives, and as a dispersant in various formulations. The presence of sulfonic acid groups imparts hydrophilicity, enhancing its interaction with water and other polar substances. Additionally, the polymer's dimensional stability and mechanical strength make it valuable in industrial applications. Its unique properties are leveraged in fields such as pharmaceuticals, textiles, and materials science, where it can serve as a functional additive or a component in composite materials. Overall, this polymer is notable for its versatility and effectiveness in enhancing the performance of various products.
Formula:C8H10O5S
InChI:InChI=1/C7H8O4S.CH2O/c8-5-6-3-1-2-4-7(6)12(9,10)11;1-2/h1-4,8H,5H2,(H,9,10,11);1H2
SMILES:c1ccc(c(c1)CO)S(=O)(=O)O.C=O
Synonyms:- Methylenebis(hydroxytoluenesulphonic acid) polymer
- Policresulen
- 2-Hydroxy-3,5-Bis(4-Hydroxy-2-Methyl-5-Sulfobenzyl)-4-Methylbenzenesulfonic Acid
- 2-(Hydroxymethyl)Benzenesulfonic Acid-Formaldehyde (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.