CAS 90111-34-5

4-hydroxy-2-methoxybenzoic acid

Description:

4-Hydroxy-2-methoxybenzoic acid, also known as gentisic acid, is an aromatic compound characterized by a hydroxyl group and a methoxy group attached to a benzoic acid framework. It typically appears as a white to pale yellow crystalline solid and is soluble in water, alcohol, and other polar solvents. The presence of both the hydroxyl and methoxy groups contributes to its polar nature, enhancing its solubility. This compound exhibits weak acidity due to the carboxylic acid functional group, allowing it to participate in various chemical reactions, such as esterification and amidation. Additionally, 4-hydroxy-2-methoxybenzoic acid is known for its antioxidant properties and potential applications in pharmaceuticals and cosmetics. Its structure allows it to engage in hydrogen bonding, which can influence its reactivity and interactions with other molecules. Overall, this compound is of interest in both synthetic chemistry and biological research due to its functional groups and associated properties.

Formula: C₈H₈O₄

InChI: InChI=1/C8H8O4/c1-12-7-4-5(9)2-3-6(7)8(10)11/h2-4,9H,1H3,(H,10,11)

SMILES: COc1cc(ccc1C(=O)O)O

Synonyms:

• Benzoic Acid, 4-Hydroxy-2-Methoxy-

4-Hydroxy-2-Methoxybenzoic Acid

CAS: 90111-34-5

Formula: C₈H₈O₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 168.1467

Ref: IN-DA019FWJ

4-Hydroxy-2-methoxybenzoic acid

CAS: 90111-34-5

4-Hydroxy-2-methoxybenzoic acid

Purity: ≥95%

Molecular weight: 168.15g/mol

Ref: 54-OR8922

4-Hydroxy-2-methoxybenzoic acid

CAS: 90111-34-5

Purity: 98%

Molecular weight: 168.147995

Ref: 10-F632943

4-Hydroxy-2-methoxybenzoic acid

CAS: 90111-34-5

Please enquire for more information about 4-Hydroxy-2-methoxybenzoic acid including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₈H₈O₄

Purity: Min. 95%

Molecular weight: 168.15 g/mol

Ref: 3D-QDA11134