CymitQuimica logo

CAS 90111-34-5

:

4-hydroxy-2-methoxybenzoic acid

Description:
4-Hydroxy-2-methoxybenzoic acid, also known as gentisic acid, is an aromatic compound characterized by a hydroxyl group and a methoxy group attached to a benzoic acid framework. It typically appears as a white to pale yellow crystalline solid and is soluble in water, alcohol, and other polar solvents. The presence of both the hydroxyl and methoxy groups contributes to its polar nature, enhancing its solubility. This compound exhibits weak acidity due to the carboxylic acid functional group, allowing it to participate in various chemical reactions, such as esterification and amidation. Additionally, 4-hydroxy-2-methoxybenzoic acid is known for its antioxidant properties and potential applications in pharmaceuticals and cosmetics. Its structure allows it to engage in hydrogen bonding, which can influence its reactivity and interactions with other molecules. Overall, this compound is of interest in both synthetic chemistry and biological research due to its functional groups and associated properties.
Formula:C8H8O4
InChI:InChI=1/C8H8O4/c1-12-7-4-5(9)2-3-6(7)8(10)11/h2-4,9H,1H3,(H,10,11)
InChI key:GWYPJBKNXSRAPX-UHFFFAOYSA-N
SMILES:COc1cc(ccc1C(=O)O)O
Synonyms:
  • Benzoic Acid, 4-Hydroxy-2-Methoxy-
Found 5 products.