CAS 90111-35-6
:2,3-Dihydro-1,4-benzodioxin-6,7-diol
Description:
2,3-Dihydro-1,4-benzodioxin-6,7-diol, with the CAS number 90111-35-6, is an organic compound characterized by its unique bicyclic structure, which includes a dioxin ring fused to a benzene ring. This compound features hydroxyl groups at the 6 and 7 positions, contributing to its potential reactivity and solubility in polar solvents. The presence of these hydroxyl groups also suggests that it may exhibit hydrogen bonding capabilities, influencing its physical properties and interactions with other molecules. Typically, compounds of this nature may be studied for their biological activity, including potential antioxidant properties or roles in various chemical reactions. Its structural features may also allow it to participate in electrophilic aromatic substitution reactions. However, specific applications, toxicity, and stability can vary, necessitating further investigation for practical uses in pharmaceuticals or materials science. As with any chemical substance, handling should be conducted with appropriate safety measures, considering its potential effects on health and the environment.
Formula:C8H8O4
InChI:InChI=1S/C8H8O4/c9-5-3-7-8(4-6(5)10)12-2-1-11-7/h3-4,9-10H,1-2H2
InChI key:InChIKey=OFJMLLBLUIVEIY-UHFFFAOYSA-N
SMILES:OC=1C=C2C(=CC1O)OCCO2
Synonyms:- 1,4-Benzodioxan-6,7-diol
- 2,3-Dihydro-1,4-benzodioxin-6,7-diol
- 1,4-Benzodioxin-6,7-diol, 2,3-dihydro-
- 2,3-Dihydro-1,4-benzodioxine-6,7-diol
- 2,3-Dihydrobenzo[b][1,4]dioxine-6,7-diol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
