CAS 90111-44-7
:2-furan-2-ylbutanedioic acid
Description:
2-Furan-2-ylbutanedioic acid, also known by its CAS number 90111-44-7, is an organic compound characterized by the presence of a furan ring and a butanedioic acid moiety. This compound features a furan substituent at the second position of the butanedioic acid, which contributes to its unique chemical properties. It is typically a solid at room temperature and is soluble in polar solvents due to the presence of carboxylic acid groups. The furan ring provides aromatic characteristics, which can influence its reactivity and stability. This compound may exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. Its structure allows for potential interactions with various biological targets, and it may participate in reactions typical of both carboxylic acids and aromatic compounds. Overall, 2-furan-2-ylbutanedioic acid is a versatile compound with applications in organic synthesis and potential implications in medicinal chemistry.
Formula:C8H8O5
InChI:InChI=1/C8H8O5/c9-7(10)4-5(8(11)12)6-2-1-3-13-6/h1-3,5H,4H2,(H,9,10)(H,11,12)
SMILES:c1cc(C(CC(=O)O)C(=O)O)oc1
Synonyms:- 2-(2-Furyl)Succinic Acid
- Butanedioic acid, 2-(2-furanyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.