CAS 901122-45-0

2-Bromoimidazo[5,1-b]thiazole-7-carboxylic acid

Description:

2-Bromoimidazo[5,1-b]thiazole-7-carboxylic acid is a heterocyclic compound characterized by the presence of both imidazole and thiazole rings, which contribute to its unique chemical properties. The compound features a bromine atom at the 2-position of the imidazole ring and a carboxylic acid functional group at the 7-position of the thiazole ring, enhancing its reactivity and potential for forming hydrogen bonds. This structure allows for various applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. The presence of the bromine atom can also influence the compound's lipophilicity and biological activity. Additionally, the carboxylic acid group can participate in acid-base reactions, making it useful in various synthetic pathways. Overall, 2-Bromoimidazo[5,1-b]thiazole-7-carboxylic acid is a versatile compound with significant implications in chemical research and drug development.

Formula: C₆H₃BrN₂O₂S

InChI: InChI=1S/C6H3BrN2O2S/c7-3-1-9-2-8-4(6(10)11)5(9)12-3/h1-2H,(H,10,11)

InChI key: InChIKey=MZUGTYNTVCMQLF-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C2N(C=C(Br)S2)C=N1

Synonyms:

• 2-Bromoimidazo[5,1-b]thiazole-7-carboxylic acid
• Imidazo[5,1-b]thiazole-7-carboxylic acid, 2-bromo-
• 2-Bromoimidazo[4,3-b][1,3]thiazole-7-carboxylic acid

2-Bromoimidazo[5,1-b]thiazole-7-carboxylic acid

CAS: 901122-45-0

Formula: C₆H₃BrN₂O₂S

Molecular weight: 247.0692

Ref: IN-DA00IG10

2-Bromoimidazo[4,3-b][1,3]thiazole-7-carboxylic acid

CAS: 901122-45-0

Versatile small molecule scaffold

Formula: C₆H₃BrN₂O₂S

Purity: Min. 95%

Molecular weight: 247.07 g/mol

Ref: 3D-BLB12245