CymitQuimica logo

CAS 90124-61-1

:

4-Ethenyl-1,3-dimethyl-1H-pyrazole

Description:
4-Ethenyl-1,3-dimethyl-1H-pyrazole, with the CAS number 90124-61-1, is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features a vinyl group (ethenyl) attached to the pyrazole, contributing to its reactivity and potential applications in various chemical reactions. The presence of two methyl groups at the 1 and 3 positions of the pyrazole ring enhances its lipophilicity and may influence its biological activity. Typically, compounds like this can exhibit properties such as being a potential ligand in coordination chemistry or serving as intermediates in organic synthesis. Additionally, the presence of the ethenyl group suggests that it may participate in polymerization reactions or serve as a building block for more complex molecules. Overall, 4-Ethenyl-1,3-dimethyl-1H-pyrazole is of interest in both synthetic organic chemistry and materials science due to its unique structural features and potential reactivity.
Formula:C7H10N2
InChI:InChI=1S/C7H10N2/c1-4-7-5-9(3)8-6(7)2/h4-5H,1H2,2-3H3
InChI key:InChIKey=LNMCFPSTJULCAS-UHFFFAOYSA-N
SMILES:C(=C)C=1C(C)=NN(C)C1
Synonyms:
  • 1H-Pyrazole, 4-ethenyl-1,3-dimethyl-
  • 4-Ethenyl-1,3-dimethyl-1H-pyrazole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.