
CAS 901273-55-0
:2-[(2-Furanylmethyl)amino]-N-(2-methoxyphenyl)acetamide
Description:
2-[(2-Furanylmethyl)amino]-N-(2-methoxyphenyl)acetamide is a chemical compound characterized by its unique structure, which includes a furan ring and an acetamide functional group. This compound features a furanylmethyl group attached to an amino group, which is further connected to an acetamide moiety that has a methoxyphenyl substituent. The presence of the furan ring contributes to its potential reactivity and biological activity, as furan derivatives are often involved in various chemical reactions and can exhibit pharmacological properties. The methoxy group on the phenyl ring may enhance lipophilicity, influencing the compound's solubility and interaction with biological targets. This compound may be of interest in medicinal chemistry for its potential applications in drug development, particularly in the search for new therapeutic agents. Its specific properties, such as melting point, solubility, and spectral characteristics, would require experimental determination or literature reference for detailed analysis.
Formula:C14H16N2O3
InChI:InChI=1S/C14H16N2O3/c1-18-13-7-3-2-6-12(13)16-14(17)10-15-9-11-5-4-8-19-11/h2-8,15H,9-10H2,1H3,(H,16,17)
InChI key:InChIKey=REKSNDXSNCTSHB-UHFFFAOYSA-N
SMILES:N(C(CNCC1=CC=CO1)=O)C2=C(OC)C=CC=C2
Synonyms:- 2-[(2-Furanylmethyl)amino]-N-(2-methoxyphenyl)acetamide
- Acetamide, 2-[(2-furanylmethyl)amino]-N-(2-methoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.