CAS 90134-00-2

3-(4-{2-[6-(dibutylamino)naphthalen-2-yl]ethenyl}pyridinium-1-yl)propane-1-sulfonate

Description:

3-(4-{2-[6-(dibutylamino)naphthalen-2-yl]ethenyl}pyridinium-1-yl)propane-1-sulfonate, with CAS number 90134-00-2, is a synthetic organic compound characterized by its complex structure, which includes a pyridinium ring, a sulfonate group, and a dibutylamino-substituted naphthalene moiety. This compound is typically used in biochemical and pharmaceutical applications, often serving as a fluorescent probe or a dye due to its conjugated system, which allows for effective light absorption and emission. Its sulfonate group enhances its solubility in aqueous environments, making it suitable for various biological assays. The presence of the dibutylamino group contributes to its lipophilicity, influencing its interaction with biological membranes. Additionally, the compound's structural features may impart specific reactivity and binding properties, making it valuable in research settings, particularly in studies involving cellular imaging or drug delivery systems. Overall, its unique combination of functional groups and structural characteristics makes it a versatile tool in chemical and biological research.

Formula: C₂₈H₃₆N₂O₃S

InChI: InChI=1/C28H36N2O3S/c1-3-5-17-30(18-6-4-2)28-13-12-26-22-25(10-11-27(26)23-28)9-8-24-14-19-29(20-15-24)16-7-21-34(31,32)33/h8-15,19-20,22-23H,3-7,16-18,21H2,1-2H3

SMILES: CCCCN(CCCC)c1ccc2cc(C=Cc3cc[n+](CCC[S-](=O)(=O)=O)cc3)ccc2c1

Di-4-ANEPPS

CAS: 90134-00-2

Formula: C₂₈H₃₆N₂O₃S

Purity: 95%

Molecular weight: 480.6620

Ref: IN-DA01E5Q4

Di-4-ANEPPS

CAS: 90134-00-2

Di-4-ANEPPS, a voltage-sensitive dye, is utilized for detecting membrane potential changes, offering a time resolution under 1 ms and fluorescence variations up

Formula: C₂₈H₃₆N₂O₃S

Color and Shape: Solid

Molecular weight: 480.66

Ref: TM-T82567

Di-4-ANEPPS

CAS: 90134-00-2

Formula: C₂₈H₃₆N₂O₃S

Purity: ≥ 95.0%

Color and Shape: Orange-red to dark red solid

Molecular weight: 480.66

Ref: 7W-GT2778

Di-4-ANEPPS

Controlled Product

CAS: 90134-00-2

Formula: C₂₈H₃₆N₂O₃S

Color and Shape: Neat

Molecular weight: 459.448

Ref: TR-D416423