CAS 90134-10-4
:4-(dibutylamino)benzaldehyde
Description:
4-(Dibutylamino)benzaldehyde is an organic compound characterized by its aromatic structure, featuring a benzaldehyde group substituted with a dibutylamino moiety at the para position. This compound typically appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. It has a relatively low solubility in water but is soluble in organic solvents such as ethanol and ether. The presence of the dibutylamino group imparts basic properties to the molecule, allowing it to participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. Additionally, 4-(dibutylamino)benzaldehyde can be used as an intermediate in the synthesis of dyes, pharmaceuticals, and other organic compounds. Its chemical reactivity is influenced by the electron-donating nature of the dibutylamino group, which can enhance electrophilic aromatic substitution reactions. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested, and appropriate personal protective equipment should be used.
Formula:C15H23NO
InChI:InChI=1/C15H23NO/c1-3-5-11-16(12-6-4-2)15-9-7-14(13-17)8-10-15/h7-10,13H,3-6,11-12H2,1-2H3
SMILES:CCCCN(CCCC)c1ccc(cc1)C=O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
4-(Dibutylamino)benzaldehyde
CAS:Formula:C15H23NOPurity:98%Color and Shape:LiquidMolecular weight:233.34924-(Dibutylamino)benzaldehyde
CAS:Formula:C15H23NOPurity:>95.0%(GC)Color and Shape:Colorless to Yellow to Orange clear liquidMolecular weight:233.364-(Dibutylamino)benzaldehyde
CAS:Controlled ProductFormula:C15H23NOColor and Shape:NeatMolecular weight:233.354-(Dibutylamino)benzaldehyde
CAS:4-(Dibutylamino)benzaldehyde is a molecule that is used in the treatment of Alzheimer's disease. It has been shown to be involved in hydrogen bond formation, which may contribute to its ability to bind with β-amyloid. This compound also has functional theory, optical properties, and photophysical properties. It emits fluorescence when it reacts with an acceptor molecule. 4-(Dibutylamino)benzaldehyde has been shown to have supramolecular properties through the use of microscopy and fluorescence microscopy. The emission wavelength can be changed by altering the solvent conditions.
Formula:C15H23NOPurity:Min. 95%Color and Shape:Clear LiquidMolecular weight:233.35 g/mol4-(Dibutlyamino)benzaldehyde
CAS:Formula:C15H23NOPurity:95.0%Color and Shape:LiquidMolecular weight:233.355






