CAS 9014-02-2: Neocarzinostatin
Description:Neocarzinostatin is a potent antitumor antibiotic derived from the bacterium *Streptomyces carzinostaticus*. It is classified as a chromoprotein and is known for its ability to induce DNA damage, making it effective in cancer treatment. The substance exhibits a complex structure, featuring a chromophore that is responsible for its biological activity. Neocarzinostatin operates primarily by intercalating into DNA and generating free radicals, leading to strand breaks and ultimately inhibiting cellular replication. This mechanism of action is particularly effective against rapidly dividing cancer cells. In terms of solubility, neocarzinostatin is typically soluble in water and exhibits stability under certain conditions, although it can be sensitive to light and temperature. Its therapeutic applications have been explored in various malignancies, and it is often studied in combination with other chemotherapeutic agents to enhance efficacy and reduce resistance. As with many chemotherapeutics, careful consideration of dosage and potential side effects is essential in clinical settings.
Formula:Unspecified
InChI:InChI=1/C35H35NO12/c1-16-12-19(42-4)14-22-20(16)8-9-23(37)27(22)32(40)45-24-13-18-10-11-35(26-15-43-34(41)46-26)25(48-35)7-5-6-21(18)31(24)47-33-28(36-3)30(39)29(38)17(2)44-33/h8-9,12-14,17,21,24-26,28-31,33,36-39H,6,15H2,1-4H3/t17-,21?,24-,25-,26-,28-,29+,30-,31-,33-,35+/m1/s1
- Synonyms:
- NSC 157365
- NSC 69856
- Zinostatin
- Neocarzinostatin
- Neocarcinostatin
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Neocarzinostatin REF: TM-T16283CAS: 9014-02-2 | 98% | To inquire | Mon 05 May 25 |

Neocarzinostatin
Ref: TM-T16283
100mg | To inquire | ||
500mg | To inquire |