
CAS 9014-90-8
:Poly(oxy-1,2-ethanediyl), α-sulfo-ω-(nonylphenoxy)-, sodium salt (1:1)
Description:
Poly(oxy-1,2-ethanediyl), α-sulfo-ω-(nonylphenoxy)-, sodium salt (CAS 9014-90-8) is a nonionic surfactant commonly used in various industrial and consumer applications. This compound features a hydrophilic poly(ethylene oxide) backbone, which enhances its solubility in water, and a hydrophobic nonylphenoxy group that contributes to its surfactant properties. The presence of a sulfonate group provides additional ionic character, improving its ability to interact with both polar and nonpolar substances. This surfactant is known for its excellent emulsifying, wetting, and dispersing capabilities, making it valuable in formulations such as detergents, cleaners, and personal care products. It is also utilized in agricultural applications as an adjuvant to enhance the efficacy of pesticides. While generally considered safe for use, it is important to handle it according to safety guidelines, as with any chemical substance, to minimize environmental impact and ensure user safety. Its biodegradability and low toxicity profile further contribute to its appeal in various formulations.
Formula:(C2H4O)nC15H24O4S·Na
Synonyms:- Sodium nonylphenoxypoly(ethyleneoxyethyl) sulfate
- Poly(oxy-1,2-ethanediyl), α-sulfo-ω-(nonylphenoxy)-, sodium salt
- Sodium poly(oxyethylene)nonylphenyl ether sulfate
- Polyethylene glycol nonylphenyl ether sulfate sodium salt
- Poly(oxy-1,2-ethanediyl), α-sulfo-ω-(nonylphenoxy)-, sodium salt (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Sulfated Poe Nonylphenol Sodium Salt
CAS:Formula:C17H29NaO6SPurity:60%Color and Shape:LiquidMolecular weight:384.4633
