CAS 9015-97-8
:Hexanoic acid, ethenyl ester, homopolymer
Description:
Hexanoic acid, ethenyl ester, homopolymer, commonly referred to as poly(hexanoic acid vinyl ester), is a synthetic polymer characterized by its structure derived from the polymerization of hexanoic acid vinyl ester monomers. This polymer exhibits properties typical of polyesters, including good flexibility, moderate tensile strength, and resistance to moisture. It is generally soluble in organic solvents and has a relatively low glass transition temperature, which contributes to its rubber-like characteristics. The polymer's hydrophobic nature makes it suitable for applications in coatings, adhesives, and sealants, where water resistance is essential. Additionally, it can be processed through various methods such as extrusion and molding, allowing for versatility in manufacturing. The polymer's thermal stability and chemical resistance can vary depending on the specific formulation and processing conditions. Overall, hexanoic acid, ethenyl ester, homopolymer is valued in industrial applications for its balance of mechanical properties and ease of processing.
Formula:(C8H14O2)x
InChI:InChI=1S/C8H14O2/c1-3-5-6-7-8(9)10-4-2/h4H,2-3,5-7H2,1H3
InChI key:InChIKey=LZWYWAIOTBEZFN-UHFFFAOYSA-N
SMILES:C(C(OC=C)=O)CCCC
Synonyms:- Hexanoic acid, vinyl ester, polymers
- Poly(vinyl caproate)
- Hexanoic acid, ethenyl ester, homopolymer
- Poly(vinyl hexanoate)
- Vinyl hexoate polymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
