CAS 90151-10-3
:4-methoxypyridine-2-carboxamide
Description:
4-Methoxypyridine-2-carboxamide, with the CAS number 90151-10-3, is an organic compound characterized by its pyridine ring structure substituted with a methoxy group and a carboxamide functional group. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar solvents, such as water and alcohols, due to the presence of the carboxamide group, which can engage in hydrogen bonding. The methoxy group enhances its lipophilicity, potentially influencing its biological activity. 4-Methoxypyridine-2-carboxamide may be utilized in various chemical syntheses and has potential applications in pharmaceuticals, particularly in the development of compounds with antimicrobial or anti-inflammatory properties. Its reactivity can be attributed to the functional groups present, allowing for further derivatization. As with many organic compounds, safety precautions should be observed when handling it, including the use of appropriate personal protective equipment, as its toxicity profile should be evaluated in specific contexts.
Formula:C7H8N2O2
InChI:InChI=1/C7H8N2O2/c1-11-5-2-3-9-6(4-5)7(8)10/h2-4H,1H3,(H2,8,10)
SMILES:COc1ccnc(c1)C(=O)N
Synonyms:- 2-Pyridinecarboxamide, 4-Methoxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Methoxy-pyridine-2-carboxylic acid amide
CAS:Formula:C7H8N2O2Purity:97%Color and Shape:SolidMolecular weight:152.15064-Methoxypyridine-2-carboxamide
CAS:4-Methoxypyridine-2-carboxamidePurity:97%Molecular weight:152.15g/mol4-Methoxy-pyridine-2-carboxylic acid amide
CAS:4-Methoxy-pyridine-2-carboxylic acid amide is a multinuclear compound that can be classified as a pyridine molecule. It has anions that are capable of hydrogen bonding, which is important for its interaction with other molecules. The compound also mimics the properties of benzene and cyclic compounds. 4-Methoxy-pyridine-2-carboxylic acid amide has been shown to have magnetic properties and catalytic activity in the presence of counterion, such as hydrogen ions or sodium hydroxide.Formula:C7H8N2O2Purity:Min. 95%Molecular weight:152.15 g/mol




