CAS 90151-12-5

5-acetyl-6-methyl-4-thioxo-3,4-dihydropyrimidin-2(1H)-one

Description:

5-acetyl-6-methyl-4-thioxo-3,4-dihydropyrimidin-2(1H)-one, with the CAS number 90151-12-5, is a heterocyclic compound belonging to the pyrimidine family. This substance features a thioxo group, which contributes to its reactivity and potential biological activity. The presence of an acetyl group and a methyl group enhances its structural diversity, making it a candidate for various chemical reactions and applications. Typically, compounds of this nature exhibit properties such as moderate solubility in organic solvents and potential interactions with biological systems, which may lead to pharmacological effects. The thioxo moiety can influence the compound's ability to participate in nucleophilic reactions, while the dihydropyrimidinone structure is often associated with a range of biological activities, including antimicrobial and anticancer properties. Overall, 5-acetyl-6-methyl-4-thioxo-3,4-dihydropyrimidin-2(1H)-one represents a class of compounds that are of interest in medicinal chemistry and drug development due to their unique structural features and potential therapeutic applications.

Formula: C₇H₈N₂O₂S

InChI: InChI=1/C7H8N2O2S/c1-3-5(4(2)10)6(12)9-7(11)8-3/h1-2H3,(H2,8,9,11,12)

SMILES: Cc1c(C(=O)C)c(nc(n1)O)S

5-Acetyl-6-methyl-4-sulfanyl-1,2-dihydropyrimidin-2-one

CAS: 90151-12-5

Versatile small molecule scaffold

Formula: C₇H₈N₂O₂S

Purity: Min. 95%

Molecular weight: 184.22 g/mol

Ref: 3D-QDA15112