CAS 90152-72-0

(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)methanol

Description:

(1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)methanol, with the CAS number 90152-72-0, is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features an ethyl group and two methyl groups attached to the pyrazole ring, contributing to its unique properties. The presence of a hydroxymethyl group (-CH2OH) indicates that it can participate in hydrogen bonding, enhancing its solubility in polar solvents. The molecular structure suggests potential applications in pharmaceuticals or agrochemicals, as pyrazole derivatives are often explored for their biological activities. Additionally, the compound's stability and reactivity can be influenced by the substituents on the pyrazole ring, which may affect its interaction with other chemical species. Overall, (1-ethyl-3,5-dimethyl-1H-pyrazol-4-yl)methanol is a versatile compound with potential utility in various chemical and biological contexts.

Formula: C₈H₁₄N₂O

InChI: InChI=1/C8H14N2O/c1-4-10-7(3)8(5-11)6(2)9-10/h11H,4-5H2,1-3H3

SMILES: CCn1c(C)c(CO)c(C)n1

Synonyms:

• 1H-Pyrazole-4-methanol, 1-ethyl-3,5-dimethyl-
• (1-Ethyl-3,5-dimethyl-1H-pyrazol-4-yl)methanol

(1-Ethyl-3,5-dimethyl-1H-pyrazol-4-yl)methanol

CAS: 90152-72-0

Formula: C₈H₁₄N₂O

Color and Shape: Solid

Molecular weight: 154.2096

Ref: IN-DA006IDC

(1-Ethyl-3,5-dimethyl-1H-pyrazol-4-yl)-methanol

CAS: 90152-72-0

Formula: C₈H₁₄N₂O

Purity: 95.0%

Molecular weight: 154.213

Ref: 10-F025303