CAS 90152-88-8
:N-(3,4,5,6-tetrahydro-2H-azepin-7-yl)glycine
Description:
N-(3,4,5,6-tetrahydro-2H-azepin-7-yl)glycine, with the CAS number 90152-88-8, is a chemical compound characterized by its unique structure that includes a glycine moiety linked to a tetrahydroazepine ring. This compound features a seven-membered nitrogen-containing heterocyclic ring, which contributes to its potential biological activity. The presence of the amino acid glycine suggests that it may interact with neurotransmitter systems, possibly influencing synaptic transmission or exhibiting neuroprotective properties. The tetrahydroazepine structure can provide conformational flexibility, which is often crucial for binding interactions in biological systems. Additionally, this compound may exhibit solubility in polar solvents due to the presence of the amino and carboxylic acid functional groups, which can engage in hydrogen bonding. Its potential applications could span various fields, including medicinal chemistry and pharmacology, particularly in the development of novel therapeutic agents targeting neurological disorders. However, specific biological activities and safety profiles would require further investigation through empirical studies.
Formula:C8H14N2O2
InChI:InChI=1/C8H14N2O2/c11-8(12)6-10-7-4-2-1-3-5-9-7/h1-6H2,(H,9,10)(H,11,12)
SMILES:C1CCC(=NCC1)NCC(=O)O
Synonyms:- glycine, N-(3,4,5,6-tetrahydro-2H-azepin-7-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
