CAS 901555-86-0

3-Chloro-6-ethylbenzo[b]thiophene-2-carbonyl chloride

Description:

3-Chloro-6-ethylbenzo[b]thiophene-2-carbonyl chloride is a chemical compound characterized by its unique structure, which includes a benzo[b]thiophene core substituted with a chloro and an ethyl group, as well as a carbonyl chloride functional group. This compound typically exhibits properties associated with halogenated aromatic compounds, such as moderate to high reactivity due to the presence of the carbonyl chloride, which can participate in nucleophilic substitution reactions. The chloro substituent can influence the compound's electronic properties, potentially enhancing its reactivity in various chemical transformations. Additionally, the ethyl group may affect the solubility and steric hindrance of the molecule. This compound is likely to be used in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals, due to its functional groups that can facilitate further chemical modifications. Safety precautions should be taken when handling this compound, as carbonyl chlorides can be hazardous and may require specific storage and disposal methods.

Formula: C₁₁H₈Cl₂OS

InChI: InChI=1/C11H8Cl2OS/c1-2-6-3-4-7-8(5-6)15-10(9(7)12)11(13)14/h3-5H,2H2,1H3

SMILES: CCc1ccc2c(c1)sc(c2Cl)C(=O)Cl

Synonyms:

• 3-Chloro-6-Ethyl-1-Benzothiophene-2-Carbonyl Chloride
• Benzo[B]Thiophene-2-Carbonyl Chloride, 3-Chloro-6-Ethyl-
• 3-Chloro-6-Ethyl-Benzothiophene-2-Carbonyl Chloride

3-Chloro-6-ethyl-1-benzothiophene-2-carbonyl chloride

CAS: 901555-86-0

Formula: C₁₁H₈Cl₂OS

Molecular weight: 259.1516

Ref: IN-DA003J9X