CAS 901555-88-2

3-methyl-2-(4-propylphenyl)quinoline-4-carboxylic acid

Description:

3-Methyl-2-(4-propylphenyl)quinoline-4-carboxylic acid is a chemical compound characterized by its complex structure, which includes a quinoline core substituted with a methyl group and a propylphenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential for various chemical reactions. The presence of the carboxylic acid functional group suggests that it can participate in acid-base reactions and may exhibit polar characteristics, influencing its solubility in different solvents. Additionally, the quinoline moiety is known for its biological activity, which may include antimicrobial or anticancer properties, making this compound of interest in medicinal chemistry. Its molecular structure allows for potential interactions with biological targets, and its derivatives may be explored for various applications in pharmaceuticals or materials science. As with many organic compounds, the specific physical properties such as melting point, boiling point, and solubility would need to be determined experimentally or sourced from reliable databases.

Formula: C₂₀H₁₉NO₂

InChI: InChI=1/C20H19NO2/c1-3-6-14-9-11-15(12-10-14)19-13(2)18(20(22)23)16-7-4-5-8-17(16)21-19/h4-5,7-12H,3,6H2,1-2H3,(H,22,23)

SMILES: CCCc1ccc(cc1)c1c(C)c(c2ccccc2n1)C(=O)O

Synonyms:

• 4-Quinolinecarboxylic Acid, 3-Methyl-2-(4-Propylphenyl)-
• 3-Methyl-2-(4-propylphenyl)quinoline-4-carboxylic acid