CAS 901586-45-6

N-methyl-1-piperidin-1-ylpropan-2-amine

Description:

N-methyl-1-piperidin-1-ylpropan-2-amine, also known by its CAS number 901586-45-6, is a chemical compound that belongs to the class of piperidine derivatives. It features a piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle, and is substituted with a methyl group and a propan-2-amine moiety. This compound is characterized by its potential biological activity, often studied in the context of pharmacology and medicinal chemistry. Its structure suggests it may interact with various neurotransmitter systems, making it of interest in research related to central nervous system effects. The presence of the piperidine ring contributes to its basicity and solubility in organic solvents. Additionally, the compound's molecular structure may influence its lipophilicity, which can affect its absorption and distribution in biological systems. As with many amines, it may exhibit properties such as hydrogen bonding and reactivity with acids, which can be relevant for its synthesis and application in drug development.

Formula: C₉H₂₀N₂

InChI: InChI=1/C9H20N2/c1-9(10-2)8-11-6-4-3-5-7-11/h9-10H,3-8H2,1-2H3

SMILES: CC(CN1CCCCC1)NC

Methyl[1-(piperidin-1-yl)propan-2-yl]amine

CAS: 901586-45-6

Versatile small molecule scaffold

Formula: C₉H₂₀N₂

Purity: Min. 95%

Molecular weight: 156.27 g/mol

Ref: 3D-BLB58645