CAS 901586-50-3

2-(1H-1,2,4-triazol-1-yl)propanoic acid

Description:

2-(1H-1,2,4-triazol-1-yl)propanoic acid, with the CAS number 901586-50-3, is a chemical compound characterized by its triazole ring structure and a propanoic acid functional group. This compound features a five-membered aromatic ring containing three nitrogen atoms, which contributes to its potential biological activity and interaction with various biological systems. The presence of the carboxylic acid group (-COOH) indicates that it can act as an acid, participating in proton transfer reactions and potentially forming salts or esters. The triazole moiety is known for its role in pharmaceuticals, particularly as a scaffold in drug design due to its ability to form hydrogen bonds and interact with biological targets. Additionally, this compound may exhibit properties such as solubility in polar solvents, making it suitable for various applications in medicinal chemistry and agrochemicals. Its unique structure may also confer specific reactivity patterns, influencing its behavior in chemical reactions and interactions with other substances.

Formula: C₅H₇N₃O₂

InChI: InChI=1/C5H7N3O2/c1-4(5(9)10)8-3-6-2-7-8/h2-4H,1H3,(H,9,10)

SMILES: CC(C(=O)O)n1cncn1

2-(1H-1,2,4-Triazol-1-yl)propanoic acid

CAS: 901586-50-3

Formula: C₅H₇N₃O₂

Molecular weight: 141.1280

Ref: IN-DA00GVEQ

2-[1,2,4]Triazol-1-yl-propionic acid

CAS: 901586-50-3

Formula: C₅H₇N₃O₂

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 141.13

Ref: 10-F058600

2-[1,2,4]Triazol-1-yl-propionic acid

CAS: 901586-50-3

Versatile small molecule scaffold

Formula: C₅H₇N₃O₂

Purity: Min. 95%

Molecular weight: 141.13 g/mol

Ref: 3D-BLB58650