CAS 901586-56-9

4-chloro-6-methyl-2-(4-methylpiperidin-1-yl)pyrimidine

Description:

4-Chloro-6-methyl-2-(4-methylpiperidin-1-yl)pyrimidine is a chemical compound characterized by its pyrimidine core, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of a chlorine atom at the 4-position and a methyl group at the 6-position contributes to its unique reactivity and potential biological activity. The compound also features a 4-methylpiperidine moiety, which is a saturated six-membered ring containing one nitrogen atom, attached at the 2-position of the pyrimidine. This structure may influence its pharmacological properties, making it of interest in medicinal chemistry. The compound is likely to exhibit moderate solubility in organic solvents and may have specific interactions with biological targets due to its functional groups. Its CAS number, 901586-56-9, allows for easy identification in chemical databases and literature. Overall, this compound's structural features suggest potential applications in drug development and research.

Formula: C₁₁H₁₆ClN₃

InChI: InChI=1/C11H16ClN3/c1-8-3-5-15(6-4-8)11-13-9(2)7-10(12)14-11/h7-8H,3-6H2,1-2H3