CymitQuimica logo

CAS 901586-62-7

:

4-Chloro-6-ethyl-2-(1-pyrrolidinyl)pyrimidine

Description:
4-Chloro-6-ethyl-2-(1-pyrrolidinyl)pyrimidine is a chemical compound characterized by its pyrimidine core, which is a six-membered heterocyclic ring containing two nitrogen atoms at positions 1 and 3. The presence of a chloro group at the 4-position and an ethyl group at the 6-position contributes to its unique reactivity and solubility properties. Additionally, the substitution of a pyrrolidine ring at the 2-position enhances its potential for biological activity, making it of interest in medicinal chemistry. This compound is typically a solid at room temperature and may exhibit moderate to high solubility in organic solvents, depending on the specific conditions. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. As with many heterocyclic compounds, it may also exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, aiding in its identification and characterization in laboratory settings. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C10H14ClN3
InChI:InChI=1S/C10H14ClN3/c1-2-8-7-9(11)13-10(12-8)14-5-3-4-6-14/h7H,2-6H2,1H3
InChI key:InChIKey=HJNGFOJOKNIVKF-UHFFFAOYSA-N
SMILES:C(C)C1=NC(=NC(Cl)=C1)N2CCCC2
Synonyms:
  • Pyrimidine, 4-chloro-6-ethyl-2-(1-pyrrolidinyl)-
  • 4-Chloro-6-ethyl-2-(1-pyrrolidinyl)pyrimidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.