CAS 90162-14-4

Ethyl 6-hydroxy-1-naphthalenecarboxylate

Description:

Ethyl 6-hydroxy-1-naphthalenecarboxylate, with the CAS number 90162-14-4, is an organic compound characterized by its naphthalene structure, which features a hydroxyl group and an ethyl ester functional group. This compound typically appears as a solid or viscous liquid, depending on its purity and temperature. It is known for its aromatic properties due to the naphthalene ring, which contributes to its potential applications in organic synthesis and as an intermediate in the production of various chemical compounds. The presence of the hydroxyl group enhances its solubility in polar solvents and may influence its reactivity, making it a useful building block in the synthesis of pharmaceuticals and agrochemicals. Additionally, the ethyl ester group can participate in esterification and transesterification reactions, further expanding its utility in chemical processes. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₃H₁₂O₃

InChI: InChI=1S/C13H12O3/c1-2-16-13(15)12-5-3-4-9-8-10(14)6-7-11(9)12/h3-8,14H,2H2,1H3

InChI key: InChIKey=IVLITUODSPOGMP-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C=1C2=C(C=CC1)C=C(O)C=C2

Synonyms:

• Ethyl 6-hydroxy-1-naphthalenecarboxylate
• 1-Naphthalenecarboxylic acid, 6-hydroxy-, ethyl ester