CAS 90180-88-4
:(3R)-3-Mercapto-1-hexanol
Description:
(3R)-3-Mercapto-1-hexanol is an organic compound characterized by the presence of a thiol (-SH) functional group and a hydroxyl (-OH) group, making it a member of the alcohol and thiol families. Its molecular structure features a six-carbon chain with the thiol group located at the third carbon, which is chiral, leading to the specific (3R) configuration. This compound is typically a colorless to pale yellow liquid with a strong, distinctive odor, often described as sulfurous or reminiscent of garlic, due to the presence of the thiol group. It is soluble in water and organic solvents, which enhances its utility in various applications, including as a flavoring agent and in the synthesis of other chemical compounds. Additionally, (3R)-3-Mercapto-1-hexanol may exhibit biological activity, making it of interest in fields such as biochemistry and pharmacology. Safety precautions should be taken when handling this substance, as thiols can be irritating to the skin and respiratory system.
Formula:C6H14OS
InChI:InChI=1S/C6H14OS/c1-2-3-6(8)4-5-7/h6-8H,2-5H2,1H3/t6-/m1/s1
InChI key:InChIKey=TYZFMFVWHZKYSE-ZCFIWIBFSA-N
SMILES:[C@@H](CCC)(CCO)S
Synonyms:- (3R)-3-Sulfanylhexan-1-ol
- 1-Hexanol, 3-mercapto-, (R)-
- (3R)-3-Mercapto-1-hexanol
- 1-Hexanol, 3-mercapto-, (3R)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(3R)-3-Mercapto-1-hexanol
CAS:Controlled ProductFormula:C6H14OSColor and Shape:NeatMolecular weight:134.24

