CAS 901889-84-7

4-{[(4-methylphenyl)amino]methyl}benzoic acid

Description:

4-{[(4-methylphenyl)amino]methyl}benzoic acid, also known by its CAS number 901889-84-7, is an organic compound characterized by its aromatic structure and functional groups. It features a benzoic acid moiety, which includes a carboxylic acid group (-COOH) attached to a benzene ring, and an amino group (-NH2) linked to a 4-methylphenyl group through a methylene bridge (-CH2-). This compound exhibits properties typical of both aromatic amines and carboxylic acids, such as potential solubility in polar solvents and the ability to participate in hydrogen bonding. Its structure suggests it may have applications in pharmaceuticals or as a chemical intermediate due to the presence of both amine and carboxylic acid functionalities, which can facilitate various chemical reactions. Additionally, the presence of the methyl group on the phenyl ring may influence its electronic properties and steric hindrance, affecting its reactivity and interactions in biological systems. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity.

Formula: C₁₅H₁₅NO₂

InChI: InChI=1/C15H15NO2/c1-11-2-8-14(9-3-11)16-10-12-4-6-13(7-5-12)15(17)18/h2-9,16H,10H2,1H3,(H,17,18)

SMILES: Cc1ccc(cc1)NCc1ccc(cc1)C(=O)O