CAS 901920-98-7

1-[(3-Methylphenyl)methyl]-4-piperidinecarboxylic acid

Description:

1-[(3-Methylphenyl)methyl]-4-piperidinecarboxylic acid, identified by its CAS number 901920-98-7, is a chemical compound characterized by its piperidine core, which is a six-membered ring containing one nitrogen atom. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity. The presence of a 3-methylphenyl group indicates that there is a methyl substituent on the phenyl ring, which can influence the compound's hydrophobicity and steric properties. The overall structure suggests that it may exhibit biological activity, potentially interacting with various biological targets due to its ability to form hydrogen bonds and engage in hydrophobic interactions. Its solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. As with many organic compounds, safety and handling precautions should be observed, particularly in laboratory settings, to mitigate any potential hazards associated with its use.

Formula: C₁₄H₁₉NO₂

InChI: InChI=1S/C14H19NO2/c1-11-3-2-4-12(9-11)10-15-7-5-13(6-8-15)14(16)17/h2-4,9,13H,5-8,10H2,1H3,(H,16,17)

InChI key: InChIKey=QRDJOEBTRLYMKT-UHFFFAOYSA-N

SMILES: C(N1CCC(C(O)=O)CC1)C2=CC(C)=CC=C2

Synonyms:

• 1-[(3-Methylphenyl)methyl]-4-piperidinecarboxylic acid
• 4-Piperidinecarboxylic acid, 1-[(3-methylphenyl)methyl]-