CAS 90197-83-4

3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)propanoic acid

Description:

3-(4,4-Dimethyl-2,5-dioxoimidazolidin-1-yl)propanoic acid, identified by its CAS number 90197-83-4, is a chemical compound that features a propanoic acid moiety linked to an imidazolidine ring. This compound is characterized by the presence of a dioxo group, which contributes to its reactivity and potential applications in various chemical processes. The dimethyl substitution on the imidazolidine ring enhances its steric properties, influencing its interactions and solubility in different solvents. As a carboxylic acid, it exhibits acidic properties, allowing it to participate in acid-base reactions. The structural features suggest potential uses in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. Additionally, the compound may exhibit specific biological activities, although detailed studies would be necessary to elucidate its full range of properties and applications. Overall, this compound represents a unique structure that may offer interesting chemical behavior and utility in various fields of chemistry.

Formula: C₈H₁₂N₂O₄

InChI: InChI=1/C8H12N2O4/c1-8(2)6(13)10(7(14)9-8)4-3-5(11)12/h3-4H2,1-2H3,(H,9,14)(H,11,12)

SMILES: CC1(C)C(=O)N(CCC(=O)O)C(=N1)O

Synonyms:

• 1-Imidazolidinepropanoic Acid, 4,4-Dimethyl-2,5-Dioxo-