CymitQuimica logo

CAS 90199-98-7

:

1,3-Cyclobutanedicarboxylic acid, dimethyl ester

Description:
1,3-Cyclobutanedicarboxylic acid, dimethyl ester is an organic compound characterized by its cyclic structure and the presence of two carboxylic acid groups that are esterified with methyl groups. This compound features a four-membered cyclobutane ring, which contributes to its unique chemical properties. The dimethyl ester form indicates that both carboxylic acid functionalities are converted into ester groups, enhancing its solubility in organic solvents and making it less acidic compared to its parent acid. Typically, compounds like this exhibit moderate polarity and can participate in various chemical reactions, including esterification and hydrolysis. The presence of the cyclobutane ring may also impart strain, influencing its reactivity and stability. This compound is of interest in synthetic organic chemistry and may serve as an intermediate in the synthesis of more complex molecules. Its applications could extend to pharmaceuticals, agrochemicals, or materials science, depending on the specific functionalization and reactivity of the compound.
Formula:C8H12O4
InChI:InChI=1S/C8H12O4/c1-11-7(9)5-3-6(4-5)8(10)12-2/h5-6H,3-4H2,1-2H3
InChI key:InChIKey=NHPHHNLWGXBMKP-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1CC(C(OC)=O)C1
Synonyms:
  • 1,3-Cyclobutanedicarboxylic acid, dimethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.