CAS 90202-27-0

α-(Chloromethyl)cyclohexanemethanol

Description:

α-(Chloromethyl)cyclohexanemethanol, identified by its CAS number 90202-27-0, is an organic compound characterized by the presence of a chloromethyl group and a hydroxymethyl group attached to a cyclohexane ring. This compound typically exhibits a colorless to pale yellow appearance and is soluble in organic solvents, reflecting its hydrophobic cyclohexane structure. The chloromethyl group introduces reactivity, making it a potential intermediate in organic synthesis, particularly in the formation of various derivatives through nucleophilic substitution reactions. The hydroxymethyl group contributes to its potential as a functionalized alcohol, which can participate in further chemical transformations. The compound's properties, such as boiling point, melting point, and specific reactivity, can vary based on its purity and the presence of other functional groups. Safety precautions should be taken when handling this compound, as it may pose health risks due to the presence of chlorine and its potential reactivity. Overall, α-(Chloromethyl)cyclohexanemethanol serves as a valuable building block in synthetic organic chemistry.

Formula: C₈H₁₅ClO

InChI: InChI=1S/C8H15ClO/c9-6-8(10)7-4-2-1-3-5-7/h7-8,10H,1-6H2

InChI key: InChIKey=AGWIKTWYCHQYTC-UHFFFAOYSA-N

SMILES: C(CCl)(O)C1CCCCC1

Synonyms:

• Cyclohexanemethanol, α-(chloromethyl)-
• 2-Chloro-1-cyclohexylethan-1-ol
• α-(Chloromethyl)cyclohexanemethanol