CAS 90203-06-8

N,1,2-Trimethyl-4-piperidinamine

Description:

N,1,2-Trimethyl-4-piperidinamine, with the CAS number 90203-06-8, is an organic compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. This compound features three methyl groups attached to the nitrogen and carbon atoms of the piperidine ring, contributing to its unique chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of the amine functional group imparts basicity to the molecule, allowing it to participate in various chemical reactions, including nucleophilic substitutions and complexation with acids. N,1,2-Trimethyl-4-piperidinamine is often utilized in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its solubility in polar solvents and moderate volatility are also notable characteristics, influencing its handling and application in laboratory settings. Safety data should be consulted to understand its toxicity and proper handling procedures.

Formula: C₈H₁₈N₂

InChI: InChI=1S/C8H18N2/c1-7-6-8(9-2)4-5-10(7)3/h7-9H,4-6H2,1-3H3

InChI key: InChIKey=AHEMOUYHIVTHGC-UHFFFAOYSA-N

SMILES: N(C)C1CC(C)N(C)CC1

N,1,2-Trimethylpiperidin-4-amine

CAS: 90203-06-8

Versatile small molecule scaffold

Formula: C₈H₁₈N₂

Purity: Min. 95%

Molecular weight: 142.24 g/mol

Ref: 3D-QDA20306