CAS 90203-08-0

1-[1-(propan-2-yl)pyrrolidin-3-yl]methanamine

Description:

1-[1-(propan-2-yl)pyrrolidin-3-yl]methanamine, with the CAS number 90203-08-0, is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring substituted with an isopropyl group and a methanamine moiety. This compound is classified as an amine due to the presence of the amine functional group (-NH2), which contributes to its basicity and potential reactivity. The presence of the pyrrolidine ring suggests that it may exhibit properties typical of cyclic amines, such as increased stability and specific steric effects. Its isopropyl substitution can influence its lipophilicity, potentially affecting its solubility in organic solvents and biological systems. The compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could interact with biological targets. However, detailed studies on its pharmacological properties, toxicity, and environmental impact would be necessary to fully understand its potential uses and safety profile.

Formula: C₈H₁₈N₂

InChI: InChI=1/C8H18N2/c1-7(2)10-4-3-8(5-9)6-10/h7-8H,3-6,9H2,1-2H3

SMILES: CC(C)N1CCC(CN)C1

Synonyms:

• 1-(1-Isopropylpyrrolidin-3-yl)methanamine
• 3-Pyrrolidinemethanamine, 1-(1-Methylethyl)-

C-(1-Isopropyl-pyrrolidin-3-yl)-methylamine

CAS: 90203-08-0

Formula: C₈H₁₈N₂

Purity: 95.0%

Molecular weight: 142.246

Ref: 10-F058613

(1-Isopropylpyrrolidin-3-yl)methylamine

CAS: 90203-08-0

Versatile small molecule scaffold

Formula: C₈H₁₈N₂

Purity: Min. 95%

Molecular weight: 142.24 g/mol

Ref: 3D-QDA20308