
CAS 90203-25-1
:N,N-Diethyl-3-(methylamino)propanamide
Description:
N,N-Diethyl-3-(methylamino)propanamide, identified by its CAS number 90203-25-1, is an organic compound characterized by its amide functional group. It features a propanamide backbone with two ethyl groups and a methylamino substituent, contributing to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents, reflecting its non-polar characteristics, while its amide functionality can engage in hydrogen bonding, influencing its reactivity and interactions. N,N-Diethyl-3-(methylamino)propanamide may exhibit biological activity, making it of interest in pharmaceutical research. Its structure suggests potential applications in medicinal chemistry, particularly in the development of drugs targeting specific biological pathways. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance, to ensure proper laboratory practices. Overall, this compound exemplifies the diverse nature of amides in organic chemistry and their relevance in various scientific fields.
Formula:C8H18N2O
InChI:InChI=1S/C8H18N2O/c1-4-10(5-2)8(11)6-7-9-3/h9H,4-7H2,1-3H3
InChI key:InChIKey=AAXAUBCKEQWDFI-UHFFFAOYSA-N
SMILES:N(C(CCNC)=O)(CC)CC
Synonyms:- N,N-Diethyl-3-(methylamino)propanamide
- Propionamide, N,N-diethyl-3-(methylamino)-
- Propanamide, N,N-diethyl-3-(methylamino)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.