CAS 90204-86-7

N-[1-(hydroxymethyl)cyclohexyl]formamide

Description:

N-[1-(hydroxymethyl)cyclohexyl]formamide, with the CAS number 90204-86-7, is an organic compound characterized by its amide functional group, which is derived from formic acid. This substance features a cyclohexyl ring substituted with a hydroxymethyl group, contributing to its unique structural properties. The presence of the hydroxymethyl group enhances its solubility in polar solvents, while the cyclohexyl moiety provides hydrophobic characteristics. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It exhibits moderate stability under standard conditions but may undergo hydrolysis in the presence of strong acids or bases. N-[1-(hydroxymethyl)cyclohexyl]formamide is of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential biological activity and utility as a building block in organic synthesis. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance, to ensure proper safety measures are taken during its use.

Formula: C₈H₁₅NO₂

InChI: InChI=1/C8H15NO2/c10-6-8(9-7-11)4-2-1-3-5-8/h7,10H,1-6H2,(H,9,11)