CAS 90205-29-1

2,2-Diethyl-4-thiazolidinecarboxylic acid

Description:

2,2-Diethyl-4-thiazolidinecarboxylic acid is an organic compound characterized by its thiazolidine ring structure, which incorporates a sulfur atom and a carboxylic acid functional group. This compound typically exhibits properties associated with thiazolidines, such as being a colorless to pale yellow liquid or solid, depending on its state at room temperature. It is soluble in polar solvents due to the presence of the carboxylic acid group, which can engage in hydrogen bonding. The diethyl substituents contribute to its hydrophobic character, influencing its solubility and reactivity. This compound may be of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activity and ability to act as a building block in synthetic pathways. Additionally, its thiazolidine structure may impart unique properties, such as the ability to participate in cyclization reactions or serve as a ligand in coordination chemistry. As with any chemical substance, safety precautions should be observed when handling it, considering potential toxicity or reactivity.

Formula: C₈H₁₅NO₂S

InChI: InChI=1S/C8H15NO2S/c1-3-8(4-2)9-6(5-12-8)7(10)11/h6,9H,3-5H2,1-2H3,(H,10,11)

InChI key: InChIKey=IQZXMNKSVKVNMN-UHFFFAOYSA-N

SMILES: C(C)C1(CC)NC(C(O)=O)CS1

Synonyms:

• 2,2-Diethyl-1,3-thiazolidine-4-carboxylic acid
• 4-Thiazolidinecarboxylic acid, 2,2-diethyl-
• 2,2-Diethyl-4-thiazolidinecarboxylic acid