CAS 90206-24-9

1H-Pyrazol-5-amine, 1-(1-ethylpropyl)-

Description:

1H-Pyrazol-5-amine, 1-(1-ethylpropyl)-, identified by its CAS number 90206-24-9, is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. This compound features an amine functional group, contributing to its reactivity and potential as a building block in organic synthesis. The presence of the 1-(1-ethylpropyl) substituent indicates that it has a branched alkyl chain, which can influence its solubility, boiling point, and overall chemical behavior. Typically, compounds like this may exhibit biological activity, making them of interest in pharmaceutical research. The specific properties, such as melting point, boiling point, and solubility, can vary based on the molecular structure and the presence of functional groups. As with many nitrogen-containing heterocycles, this compound may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it valuable in synthetic organic chemistry. Safety and handling precautions should be observed due to the potential reactivity of amines.

Formula: C₈H₁₅N₃

InChI: InChI=1/C8H15N3/c1-3-7(4-2)11-8(9)5-6-10-11/h5-7H,3-4,9H2,1-2H3

InChI key: InChIKey=QBYQURHAANTNOY-UHFFFAOYSA-N

SMILES: C(CC)(CC)N1C(N)=CC=N1

Synonyms:

• 1-(pentan-3-yl)-1H-pyrazol-5-amine
• 1H-pyrazol-5-amine, 1-(1-ethylpropyl)-
• 2-Pentan-3-ylpyrazol-3-amine
• Pyrazole, 5-amino-1-(1-ethylpropyl)-
• 1-(1-Ethylpropyl)-1H-pyrazol-5-amine

1-(1-ethylpropyl)-1H-pyrazol-5-amine

CAS: 90206-24-9

Formula: C₈H₁₅N₃

Molecular weight: 153.2248

Ref: IN-DA00GTI6