CymitQuimica logo

CAS 90209-81-7

:

N-(2-Aminophenyl)-2-pyridinecarboxamide

Description:
N-(2-Aminophenyl)-2-pyridinecarboxamide, also known by its CAS number 90209-81-7, is an organic compound characterized by its structural features, which include an amine group and a pyridine ring. This compound typically exhibits properties associated with both aromatic amines and carboxamides, such as moderate solubility in polar solvents due to the presence of the amide functional group. It may display biological activity, making it of interest in medicinal chemistry and drug development. The compound's molecular structure allows for potential interactions with biological targets, which can be explored for therapeutic applications. Additionally, its stability and reactivity can be influenced by the presence of the amino and pyridine groups, which may participate in hydrogen bonding and other intermolecular interactions. Overall, N-(2-Aminophenyl)-2-pyridinecarboxamide represents a class of compounds that can be valuable in various chemical and pharmaceutical research contexts.
Formula:C12H11N3O
InChI:InChI=1S/C12H11N3O/c13-9-5-1-2-6-10(9)15-12(16)11-7-3-4-8-14-11/h1-8H,13H2,(H,15,16)
InChI key:InChIKey=XIQCXQUJFNTCCK-UHFFFAOYSA-N
SMILES:N(C(=O)C1=CC=CC=N1)C2=C(N)C=CC=C2
Synonyms:
  • N-(2-Aminophenyl)-2-pyridinecarboxamide
  • CZC 55236
  • 2-Pyridinecarboxamide, N-(2-aminophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.