CAS 90211-01-1

1,2,4-Thiadiazole-3-acetyl chloride, 5-[(dichlorophosphinyl)amino]-α-(ethoxyimino)-, (αZ)-

Description:

1,2,4-Thiadiazole-3-acetyl chloride, 5-[(dichlorophosphinyl)amino]-α-(ethoxyimino)-, (αZ)- is a chemical compound characterized by its unique structure that includes a thiadiazole ring, an acetyl chloride functional group, and a dichlorophosphinyl amino group. This compound is likely to exhibit properties typical of both thiadiazoles and acyl chlorides, such as reactivity towards nucleophiles due to the presence of the acetyl chloride moiety. The presence of the dichlorophosphinyl group suggests potential applications in organophosphorus chemistry, possibly as a precursor for further chemical synthesis or as a bioactive agent. The ethoxyimino group may impart specific reactivity or solubility characteristics, influencing its behavior in various chemical environments. Overall, this compound's structure indicates potential utility in agrochemicals or pharmaceuticals, although specific applications would depend on further research into its biological activity and reactivity. Safety data and handling precautions should be considered due to the presence of reactive functional groups.

Formula: C₆H₆Cl₃N₄O₃PS

InChI: InChI=1S/C6H6Cl3N4O3PS/c1-2-16-11-3(4(7)14)5-10-6(18-13-5)12-17(8,9)15/h2H2,1H3,(H,10,12,13,15)/b11-3+

InChI key: InChIKey=QZZOGRZCLZKNBM-QDEBKDIKSA-N

SMILES: C(=N\OCC)(\C(Cl)=O)/C=1N=C(NP(Cl)(Cl)=O)SN1

Synonyms:

• 1,2,4-Thiadiazole-3-acetyl chloride, 5-[(dichlorophosphinyl)amino]-α-(ethoxyimino)-, (αZ)-
• 1,2,4-Thiadiazole-3-acetyl chloride, 5-[(dichlorophosphinyl)amino]-α-(ethoxyimino)-, (Z)-
• (Z)-2-(5-Dichlorophosphinylamino-1,2,4-thiadiazol-3-yl)-2-ethoxyiminoacetyl chloride