CAS 90212-80-9
:2-[[Bis(4-fluorophenyl)methyl]sulfinyl]-N-hydroxyacetamide
Description:
2-[[Bis(4-fluorophenyl)methyl]sulfinyl]-N-hydroxyacetamide, with the CAS number 90212-80-9, is a chemical compound characterized by its unique structural features, including a sulfinyl group and a hydroxylamine moiety. This compound typically exhibits properties associated with both sulfoxides and amides, which may influence its reactivity and solubility. The presence of the bis(4-fluorophenyl)methyl group suggests potential applications in medicinal chemistry, particularly due to the fluorine substituents that can enhance biological activity and lipophilicity. The hydroxamic acid functionality may also impart chelating properties, making it relevant in coordination chemistry and enzyme inhibition studies. In terms of physical properties, it is likely to be a solid at room temperature, with potential for moderate solubility in polar organic solvents. The compound's stability, reactivity, and potential applications would depend on the specific conditions under which it is used, including pH and temperature. Overall, this compound represents a class of molecules that may have significant implications in pharmaceutical research and development.
Formula:C15H13F2NO3S
InChI:InChI=1S/C15H13F2NO3S/c16-12-5-1-10(2-6-12)15(22(21)9-14(19)18-20)11-3-7-13(17)8-4-11/h1-8,15,20H,9H2,(H,18,19)
InChI key:InChIKey=VKGUUSVYPXTWMA-UHFFFAOYSA-N
SMILES:C(S(CC(NO)=O)=O)(C1=CC=C(F)C=C1)C2=CC=C(F)C=C2
Synonyms:- 2-[[Bis(4-fluorophenyl)methyl]sulfinyl]-N-hydroxyacetamide
- Crl 40,941
- Fladrafinil
- Fluorafinil
- Acetamide, 2-[[bis(4-fluorophenyl)methyl]sulfinyl]-N-hydroxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
CRL-40,941
CAS:Controlled ProductApplications CRL-40,941 is a wakefulness-promoting agent. It was found to produce antiaggressive effects in animals.
References Lafon, L.: US4489095 (A) (1984)Formula:C15H13F2NO3SColor and Shape:WhiteMolecular weight:325.332-[[Bis(4-fluorophenyl)methyl]sulfinyl]-N-hydroxyacetamide
CAS:Controlled Product2-[[Bis(4-fluorophenyl)methyl]sulfinyl]-N-hydroxyacetamide (Fluoroamphetamine) is a potent stimulant of the central nervous system. It has been used in off-label applications, such as boosting and monitoring, for the treatment of symptoms of Parkinson's disease and other conditions. Fluoroamphetamine is structurally related to amphetamine, but is more potent and has a longer duration of action. It is an analog of modafinil, which has been shown to have antibiotic properties, although it is not active against bacteria. Fluoroamphetamine binds to sulfoxide reductase enzymes, which are involved in the synthesis of sulfoxides that are important for neurotransmitter release. This binding prevents the enzyme from reducing sulfoxides to sulfides, which may be responsible for its effects on neurotransmitters in the brain.Formula:C15H13F2NO3SPurity:Min. 95%Molecular weight:325.33 g/mol

